Age | Commit message (Collapse) | Author |
|
EventContent::Base has been made primarily for the sake of dynamic
polymorphism needed within RoomMessageEvent content (arguably, it might
not be really needed even there, but that's a bigger matter for another
time). When that polymorphism is not needed, it's easier for reading
and maintenance to have toJson() member function (or even specialise
JsonConverter<> outside of the content structure) instead of deriving
from EC::Base and then still having fillJson() member function. This
commit removes EventContent::Base dependency where it's not beneficial.
|
|
Main changes:
1. Base::fillJson() gets a QJsonObject& instead of QJsonObject* - c'mon,
there's nothing inherently wrong with using an lvalue reference for a
read-write parameter.
2. UrlWithThumbnailContent merged into UrlBasedContent. The original
UrlBasedContent was only used to produce a single class,
AudioContent, and even that can logically have a thumbnail even if
the spec doesn't provision that. And there's no guarantee even for
visual content (ImageContent, e.g.) to have thumbnail data; the
fallback is already tested.
3. toInfoJson is converted from a template to a couple of overloads
that supersede fillInfoJson() member functions in FileInfo/ImageInfo.
These overloads are easier on the eye; and clang-tidy no more warns
about ImageInfo::fillInfoJson() shadowing FileInfo::fillInfoJson().
4. Now that UrlWithThumbnail is gone, PlayableContent can directly
derive from UrlBasedContent since both its specialisations use it.
5. Instead of FileInfo/ImageInfo, fillInfoJson() has been reinvented
within UrlBasedContent so that, in particular, PlayableContent
wouldn't need to extract 'info' subobject and then roll it back
inside the content JSON object.
|
|
|
|
Also: extended quotest to cover member renames, not just user profile renames.
|
|
|
|
Closes #514.
|
|
Instead of being defined independently, JoinState now uses values from
the Membership enumeration (former MemberEventContent::MembershipType)
that was moved to quotient_common.h for that purpose. Both enumerations
gained a Q_FLAG_NS decoration and operator<< overrides that strip
"Quotient::" prefix when dumping member/join state values to the log -
obviating toCString(JoinState) along the way. Quotient::MembershipType
alias is deprecated from now.
|
|
After going through all the files and the history of commits on them
it was clear that some copyright statements are obsolete (the code has
been overwritten since) and some are missing. This commit tries best to
remedy that, along with adding SPDX tags where they were still not used.
Also, a minimal SPDX convention is documented for further contributions.
Closes #426.
|
|
|
|
|
|
* QT_NO_URL_CAST_FROM_STRING makes it clearer where QUrls are created
from QStrings (which incurs a parsing cost).
* QT_STRICT_ITERATORS helps detecting where begin()/end() is used
instead of cbegin()/cend(). KDE developers have verified that
the generated assembly code is identical.
|
|
This is a usual situation when a membership type is undefined; and
the current code constructs _a lot_ of stub events by loading them from
empty JSON. So just silence those warnings for now.
|
|
MemberEventContent: displayname and avatarUrl are now Omittables;
CS API doesn't guarantee their presence (see also
https://github.com/matrix-org/matrix-doc/issues/1375) but Quotient
used to assume they are always there, causing #412.
RoomMemberEvent: displayname() -> newDisplayName() and
avatarUrl() -> newAvatarUrl(), to emphasise the actual semantics (and
also the changed interface). The old signatures still work but are
deprecated.
Instead of roomMembername() (with weird camel-casing), three new
methods in addition to safeMemberName() are introduced to Room:
- memberName() - produces the "best known" display name for a
given member; User::name() uses it to avoid the pitfall of #412.
- disambiguatedMemberName() - this is what roomMembername() used to be;
not recommended for direct use when UI is concerned.
- safeMemberName() - remains as is, with the fix to the documentation
that used to mislead that the function returns HTML-escaped content
(it didn't, and doesn't).
- htmlSafeMemberName() - does what safeMemberName() claimed to do.
Respectively, memberNames() is deprecated in favor of safeMemberNames()
and htmlSafeMemberNames(). The corresponding Q_PROPERTY uses
safeMemberNames() now.
Similar to memberName(), Room has got memberAvatarUrl() to spare
User class from diving into Room state to find the member avatar URL.
Closes #412.
|
|
|
|
See https://github.com/matrix-org/matrix-doc/pull/2367. Closes #370.
|
|
|
|
|
|
# Conflicts:
# CMakeLists.txt
# lib/avatar.cpp
# lib/connection.cpp
# lib/connection.h
# lib/connectiondata.cpp
# lib/csapi/account-data.cpp
# lib/csapi/account-data.h
# lib/csapi/capabilities.cpp
# lib/csapi/capabilities.h
# lib/csapi/content-repo.cpp
# lib/csapi/create_room.cpp
# lib/csapi/filter.cpp
# lib/csapi/joining.cpp
# lib/csapi/keys.cpp
# lib/csapi/list_joined_rooms.cpp
# lib/csapi/notifications.cpp
# lib/csapi/openid.cpp
# lib/csapi/presence.cpp
# lib/csapi/pushrules.cpp
# lib/csapi/registration.cpp
# lib/csapi/room_upgrades.cpp
# lib/csapi/room_upgrades.h
# lib/csapi/search.cpp
# lib/csapi/users.cpp
# lib/csapi/versions.cpp
# lib/csapi/whoami.cpp
# lib/csapi/{{base}}.cpp.mustache
# lib/events/accountdataevents.h
# lib/events/eventcontent.h
# lib/events/roommemberevent.cpp
# lib/events/stateevent.cpp
# lib/jobs/basejob.cpp
# lib/jobs/basejob.h
# lib/networkaccessmanager.cpp
# lib/networksettings.cpp
# lib/room.cpp
# lib/room.h
# lib/settings.cpp
# lib/settings.h
# lib/syncdata.cpp
# lib/user.cpp
# lib/user.h
# lib/util.cpp
|
|
MemberEventContent::displayName() will strip away Unicode text direction override characters. Direct access to JSON can still provide "raw" data.
|
|
|
|
Both now use through a common JsonConverter<> template class with its
base definition tuned for structs/QJsonObjects and specialisations for
non-object types. This new implementation doesn't work with virtual
fillJson functions yet (so EventContent classes still use toJson as a
member function) and does not cope quite well with non-constructible
objects (you have to specialise JsonConverter<> rather than, more
intuitively, JsonObjectConverter<>), but overall is more streamlined
compared to the previous implementation. It also fixes one important
issue that pushed for a rewrite: the previous implementation was not
working with structure hierarchies at all so (in particular) the Filter
part of CS API was totally disfunctional.
|
|
|
|
We now have event.*, roomevent.*, stateevent.* and eventloader.h. If you only use event leaf-classes (such as RoomMemberEvent) you shouldn't notice anything.
|
|
There were two common points that had to be updated every time a new event is introduced:
the EventType enumeration and one of 3 doMakeEvent<> specialisations. The new code
has a template class, EventFactory<>, that uses a list of static factory methods
to create events instead of typelists used in doMakeEvent<>(); the EventType enumeration
is replaced with a namespace populated with constants as necessary.
In general, EventType is considered a deprecated mechanism altogether; instead, a set
of facilities is provided: is<>() to check if an event has a certain type (to replace
comparison against an EventType value) and visit<>() to execute actions based on
the event type (replacing switch statements over EventType values).
Closes #129.
|
|
It's been long overdue to separate them from the rest of the stuff (docs etc.). Also, this allows installing to a directory within the checked out git tree (say, ./install/, similar to ./build/).
|