| Age | Commit message (Collapse) | Author |
|---|
|
EventContent::Base has been made primarily for the sake of dynamic
polymorphism needed within RoomMessageEvent content (arguably, it might
not be really needed even there, but that's a bigger matter for another
time). When that polymorphism is not needed, it's easier for reading
and maintenance to have toJson() member function (or even specialise
JsonConverter<> outside of the content structure) instead of deriving
from EC::Base and then still having fillJson() member function. This
commit removes EventContent::Base dependency where it's not beneficial.
|
|
Main changes:
1. Base::fillJson() gets a QJsonObject& instead of QJsonObject* - c'mon,
there's nothing inherently wrong with using an lvalue reference for a
read-write parameter.
2. UrlWithThumbnailContent merged into UrlBasedContent. The original
UrlBasedContent was only used to produce a single class,
AudioContent, and even that can logically have a thumbnail even if
the spec doesn't provision that. And there's no guarantee even for
visual content (ImageContent, e.g.) to have thumbnail data; the
fallback is already tested.
3. toInfoJson is converted from a template to a couple of overloads
that supersede fillInfoJson() member functions in FileInfo/ImageInfo.
These overloads are easier on the eye; and clang-tidy no more warns
about ImageInfo::fillInfoJson() shadowing FileInfo::fillInfoJson().
4. Now that UrlWithThumbnail is gone, PlayableContent can directly
derive from UrlBasedContent since both its specialisations use it.
5. Instead of FileInfo/ImageInfo, fillInfoJson() has been reinvented
within UrlBasedContent so that, in particular, PlayableContent
wouldn't need to extract 'info' subobject and then roll it back
inside the content JSON object.
|
|
Because Apple Clang choked on `explicit(false)`.
|
|
Default construction was only done to support stubbed state in Room
and even that did not really use those, opting to construct an event
from an empty QJsonObject instead. Now that Room doesn't have
stubbed state, default constructors are even less needed.
|
|
This include all (hopefully) classes/structures and functions that have
non-inline definitions, as well as namespaces with Q_NAMESPACE since
those have non-inline (as of Qt 5.15) QMetaObject - for that a new
macro, QUO_NAMESPACE, has been devised to accommodate the lack of
Q_NAMESPACE_EXPORT in Qt before 5.14.
|
|
EncryptionEvent constructor
|
|
Now that QMetaType introspects into types, it reveals hidden problems
(which is very nice of it).
|
|
After going through all the files and the history of commits on them
it was clear that some copyright statements are obsolete (the code has
been overwritten since) and some are missing. This commit tries best to
remedy that, along with adding SPDX tags where they were still not used.
Also, a minimal SPDX convention is documented for further contributions.
Closes #426.
|
|
|
|
In particular: removed unnecessary #includes, deprecated and no more
used constructs, replaced stored members with dynamic generation
from JSON (TypingEvent and, especially promising for performance,
ReceiptEvent)
|
|
|
|
They've been deprecated for almost a year by now.
|
|
|
|
|
|
|
|
|
|
|
|
This allows to detect if a room has been encrypted (no room state, just
an event as of yet). Closes #84.
|
