Age | Commit message (Collapse) | Author |
|
Not that it was very important, as the two are basically the same thing
(and matrixTypeId() is about to be obsoleted); but formally basicJson()
is supposed to get the former, not the latter.
|
|
This makes it easier and more intuitive to build a minimal JSON payload
for a given event type. A common basicJson() call point is also
convenient in template contexts (see next commits).
|
|
EventContent::Base has been made primarily for the sake of dynamic
polymorphism needed within RoomMessageEvent content (arguably, it might
not be really needed even there, but that's a bigger matter for another
time). When that polymorphism is not needed, it's easier for reading
and maintenance to have toJson() member function (or even specialise
JsonConverter<> outside of the content structure) instead of deriving
from EC::Base and then still having fillJson() member function. This
commit removes EventContent::Base dependency where it's not beneficial.
|
|
Main changes:
1. Base::fillJson() gets a QJsonObject& instead of QJsonObject* - c'mon,
there's nothing inherently wrong with using an lvalue reference for a
read-write parameter.
2. UrlWithThumbnailContent merged into UrlBasedContent. The original
UrlBasedContent was only used to produce a single class,
AudioContent, and even that can logically have a thumbnail even if
the spec doesn't provision that. And there's no guarantee even for
visual content (ImageContent, e.g.) to have thumbnail data; the
fallback is already tested.
3. toInfoJson is converted from a template to a couple of overloads
that supersede fillInfoJson() member functions in FileInfo/ImageInfo.
These overloads are easier on the eye; and clang-tidy no more warns
about ImageInfo::fillInfoJson() shadowing FileInfo::fillInfoJson().
4. Now that UrlWithThumbnail is gone, PlayableContent can directly
derive from UrlBasedContent since both its specialisations use it.
5. Instead of FileInfo/ImageInfo, fillInfoJson() has been reinvented
within UrlBasedContent so that, in particular, PlayableContent
wouldn't need to extract 'info' subobject and then roll it back
inside the content JSON object.
|
|
|
|
With the reworked JsonConverter code it is possible to work uniformly
with structures that have a member toJson() and a constructor converting
from QJsonObject, as well as with structures that rely on an external
JsonConverter specialisation.
|
|
This is a rework of EventContent::SimpleContent previously defined in
simplestateevents.h. Quite a few events (and not only state events) have
just a single key-value pair in their content - this structure (which
is really just a template wrapper around the value) and the accompanying
JsonConverter<> specialisation encapsulate the concept to streamline
definition of such events. This commit only has simplestateevents.h
using it; further commits will use SingleKeyValue in other places.
toSnakeCase is a facility function that converts camelCase used for
C++ variables into snake_case used in JSON payloads. Combined with
the preprocessor trick that makes a string literal from an identifier,
this allows to reduce boilerplate code that repeats the same name for
fields in C++ event classes and fields in JSON. SingleKeyValue uses it,
and there are other cases for it coming.
|
|
|
|
Yet another missing header from times when .h files weren't added to
CMakeLists.
|
|
|
|
|
|
Add a macro to make slicing clear in the code and quiet for static
analysis.
|
|
|
|
|
|
Check edKey when receiving an olm message and prepare for MSC 3700
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Store some more things in the database
|
|
|
|
Co-authored-by: Carl Schwan <carl@carlschwan.eu>
|
|
|
|
Is required to correctly choose a session to use for sending messages
|
|
|
|
|
|
|
|
signature checks
|
|
|
|
Building with static libs fails on QtKeychain apparently underlinking
with glib when --coverage is passed.
|
|
Co-authored-by: Carl Schwan <carl@carlschwan.eu>
|
|
|